C12H11ClO5 — CID 117429556
ethyl 2-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-oxoacetate (PubChem CID 117429556) has the molecular formula C12H11ClO5 and a molecular weight of 270.67 g/mol. Its IUPAC name is ethyl 2-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117429556 |
| Molecular Formula | C12H11ClO5 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | ethyl 2-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C12H11ClO5/c1-2-17-12(15)10(14)9-4-8(13)3-7-5-16-6-18-11(7)9/h3-4H,2,5-6H2,1H3 |
| InChIKey | ICFXMZNHDZRTIO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|