C14H13Cl3O4 — CID 7864044
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864044) has the molecular formula C14H13Cl3O4 and a molecular weight of 351.61 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864044 |
| Molecular Formula | C14H13Cl3O4 |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)OCc2cc(Cl)cc3c2OCOC3)CC1(Cl)Cl |
| InChI | InChI=1S/C14H13Cl3O4/c1-13(6-14(13,16)17)12(18)20-5-9-3-10(15)2-8-4-19-7-21-11(8)9/h2-3H,4-7H2,1H3/t13-/m1/s1 |
| InChIKey | WHTSZSXMLNGYIT-CYBMUJFWSA-N |
| XLogP | 3.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|