C15H10Cl3NO4 — CID 55308827
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,6-dichloropyridine-2-carboxylate (PubChem CID 55308827) has the molecular formula C15H10Cl3NO4 and a molecular weight of 374.61 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,6-dichloropyridine-2-carboxylate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 55308827 |
| Molecular Formula | C15H10Cl3NO4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc2c1OCOC2)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H10Cl3NO4/c16-10-3-8-5-21-7-23-14(8)9(4-10)6-22-15(20)13-11(17)1-2-12(18)19-13/h1-4H,5-7H2 |
| InChIKey | QJPOPKBRGLOVJC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|