C13H13FO5 — CID 117423972
ethyl 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]-2-oxoacetate (PubChem CID 117423972) has the molecular formula C13H13FO5 and a molecular weight of 268.24 g/mol. Its IUPAC name is ethyl 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 117423972 |
| Molecular Formula | C13H13FO5 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | ethyl 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(C(C)F)cc2c1OCO2 |
| InChI | InChI=1S/C13H13FO5/c1-3-17-13(16)11(15)9-4-8(7(2)14)5-10-12(9)19-6-18-10/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | QCWWUCALEQTUJC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|