C11H14FNO3 — CID 117326465
O-[2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]ethyl]hydroxylamine (PubChem CID 117326465) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is O-[2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]ethyl]hydroxylamine.
| Compound Name | O-[2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117326465 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | O-[2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]ethyl]hydroxylamine |
| SMILES | CC(F)c1cc(CCON)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H14FNO3/c1-7(12)9-4-8(2-3-16-13)11-10(5-9)14-6-15-11/h4-5,7H,2-3,6,13H2,1H3 |
| InChIKey | YOJVUASZBKGHPF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|