C10H12BrNO3 — CID 117437374
O-[2-(6-bromo-7-methyl-1,3-benzodioxol-5-yl)ethyl]hydroxylamine (PubChem CID 117437374) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is O-[2-(6-bromo-7-methyl-1,3-benzodioxol-5-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(6-bromo-7-methyl-1,3-benzodioxol-5-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117437374 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | O-[2-(6-bromo-7-methyl-1,3-benzodioxol-5-yl)ethyl]hydroxylamine |
| SMILES | Cc1c(Br)c(CCON)cc2c1OCO2 |
| InChI | InChI=1S/C10H12BrNO3/c1-6-9(11)7(2-3-15-12)4-8-10(6)14-5-13-8/h4H,2-3,5,12H2,1H3 |
| InChIKey | QEDMXNCZVUACLK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|