C11H10FNO2 — CID 84779364
2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]acetonitrile (PubChem CID 84779364) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]acetonitrile.
| Compound Name | 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 84779364 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]acetonitrile |
| SMILES | CC(F)c1cc(CC#N)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H10FNO2/c1-7(12)9-4-8(2-3-13)11-10(5-9)14-6-15-11/h4-5,7H,2,6H2,1H3 |
| InChIKey | KOHZPOXADCUZKC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |