C9H9ClO3 — CID 16770161
(6-chloro-4H-1,3-benzodioxin-8-yl)methanol (PubChem CID 16770161) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methanol.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methanol |
|---|---|
| PubChem CID | 16770161 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methanol |
| SMILES | OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C9H9ClO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-2,11H,3-5H2 |
| InChIKey | AUQHUFGUFBVONH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |