C11H13ClO2S — CID 165347689
6-chloro-8-(ethylsulfanylmethyl)-4H-1,3-benzodioxine (PubChem CID 165347689) has the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. Its IUPAC name is 6-chloro-8-(ethylsulfanylmethyl)-4H-1,3-benzodioxine.
| Compound Name | 6-chloro-8-(ethylsulfanylmethyl)-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 165347689 |
| Molecular Formula | C11H13ClO2S |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-chloro-8-(ethylsulfanylmethyl)-4H-1,3-benzodioxine |
| SMILES | CCSCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C11H13ClO2S/c1-2-15-6-9-4-10(12)3-8-5-13-7-14-11(8)9/h3-4H,2,5-7H2,1H3 |
| InChIKey | QLIACIKCRRSABU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |