C16H16ClNO2S — CID 79131094
2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-6-methylaniline (PubChem CID 79131094) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-6-methylaniline.
| Compound Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-6-methylaniline |
|---|---|
| PubChem CID | 79131094 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-6-methylaniline |
| SMILES | Cc1cccc(SCc2cc(Cl)cc3c2OCOC3)c1N |
| InChI | InChI=1S/C16H16ClNO2S/c1-10-3-2-4-14(15(10)18)21-8-12-6-13(17)5-11-7-19-9-20-16(11)12/h2-6H,7-9,18H2,1H3 |
| InChIKey | UHFVZMFBMHSQCN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|