C13H19Cl2NO2 — CID 18528283
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl-diethylazanium chloride (PubChem CID 18528283) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl-diethylazanium chloride.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl-diethylazanium chloride |
|---|---|
| PubChem CID | 18528283 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)Cc1cc(Cl)cc2c1OCOC2.[Cl-] |
| InChI | InChI=1S/C13H18ClNO2.ClH/c1-3-15(4-2)7-10-5-12(14)6-11-8-16-9-17-13(10)11;/h5-6H,3-4,7-9H2,1-2H3;1H |
| InChIKey | RCBCKXCGCNWNQA-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |