C14H13ClNO2+ — CID 2804478
1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium (PubChem CID 2804478) has the molecular formula C14H13ClNO2+ and a molecular weight of 262.72 g/mol. Its IUPAC name is 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium.
| Compound Name | 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 2804478 |
| Molecular Formula | C14H13ClNO2+ |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium |
| SMILES | Clc1cc2c(c(C[n+]3ccccc3)c1)OCOC2 |
| InChI | InChI=1S/C14H13ClNO2/c15-13-6-11(8-16-4-2-1-3-5-16)14-12(7-13)9-17-10-18-14/h1-7H,8-10H2/q+1 |
| InChIKey | KHWLRAWQSWKUDA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|