C10H11ClO4 — CID 117333233
2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)ethanol (PubChem CID 117333233) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 117333233 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)ethanol |
| SMILES | COc1c(CCO)cc2c(c1Cl)OCO2 |
| InChI | InChI=1S/C10H11ClO4/c1-13-9-6(2-3-12)4-7-10(8(9)11)15-5-14-7/h4,12H,2-3,5H2,1H3 |
| InChIKey | SSFJIFPLDJTFEM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |