C13H13ClO5 — CID 117458127
ethyl 2-(4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-2-oxoacetate (PubChem CID 117458127) has the molecular formula C13H13ClO5 and a molecular weight of 284.69 g/mol. Its IUPAC name is ethyl 2-(4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117458127 |
| Molecular Formula | C13H13ClO5 |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | ethyl 2-(4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(OC)c2c(c1Cl)CCO2 |
| InChI | InChI=1S/C13H13ClO5/c1-3-18-13(16)11(15)8-6-9(17-2)12-7(10(8)14)4-5-19-12/h6H,3-5H2,1-2H3 |
| InChIKey | MJTWIUMUCSAAHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|