C10H9ClO3 — CID 117275802
4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-carbaldehyde (PubChem CID 117275802) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is 4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-carbaldehyde.
| Compound Name | 4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 117275802 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-chloro-7-methoxy-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| SMILES | COc1cc(C=O)c(Cl)c2c1OCC2 |
| InChI | InChI=1S/C10H9ClO3/c1-13-8-4-6(5-12)9(11)7-2-3-14-10(7)8/h4-5H,2-3H2,1H3 |
| InChIKey | XXUUDRAKWICGQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|