C12H13BrO3 — CID 117458946
3-(4-bromo-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)propanal (PubChem CID 117458946) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 3-(4-bromo-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)propanal.
| Compound Name | 3-(4-bromo-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)propanal |
|---|---|
| PubChem CID | 117458946 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 3-(4-bromo-7-methoxy-2,3-dihydro-1-benzofuran-5-yl)propanal |
| SMILES | COc1cc(CCC=O)c(Br)c2c1OCC2 |
| InChI | InChI=1S/C12H13BrO3/c1-15-10-7-8(3-2-5-14)11(13)9-4-6-16-12(9)10/h5,7H,2-4,6H2,1H3 |
| InChIKey | KAJZGTJZCSBLMB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|