C12H14O4 — CID 158241343
4-(7-methoxy-1,3-benzodioxol-5-yl)butanal (PubChem CID 158241343) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-(7-methoxy-1,3-benzodioxol-5-yl)butanal.
| Compound Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)butanal |
|---|---|
| PubChem CID | 158241343 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)butanal |
| SMILES | COc1cc(CCCC=O)cc2c1OCO2 |
| InChI | InChI=1S/C12H14O4/c1-14-10-6-9(4-2-3-5-13)7-11-12(10)16-8-15-11/h5-7H,2-4,8H2,1H3 |
| InChIKey | NUMNTEOICULFFV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|