C21H26N2O6 — CID 134686709
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine (PubChem CID 134686709) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 134686709 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine |
| SMILES | COc1cc(CNCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C21H26N2O6/c1-24-16-6-14(8-18-20(16)28-12-26-18)10-22-4-3-5-23-11-15-7-17(25-2)21-19(9-15)27-13-29-21/h6-9,22-23H,3-5,10-13H2,1-2H3 |
| InChIKey | HCXASWJULMHYCF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|