C25H34N2O6 — CID 53484108
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]heptane-1,7-diamine (PubChem CID 53484108) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]heptane-1,7-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 53484108 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]heptane-1,7-diamine |
| SMILES | COc1cc(CNCCCCCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C25H34N2O6/c1-28-20-10-18(12-22-24(20)32-16-30-22)14-26-8-6-4-3-5-7-9-27-15-19-11-21(29-2)25-23(13-19)31-17-33-25/h10-13,26-27H,3-9,14-17H2,1-2H3 |
| InChIKey | FSQWGCQSCBWZSL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|