C12H12O7 — CID 170895488
2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propanedioic acid (PubChem CID 170895488) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propanedioic acid.
| Compound Name | 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 170895488 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]propanedioic acid |
| SMILES | COc1cc(CC(C(=O)O)C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C12H12O7/c1-17-8-3-6(2-7(11(13)14)12(15)16)4-9-10(8)19-5-18-9/h3-4,7H,2,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | KRKQSPVYCCEGEI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|