C12H14ClNO5 — CID 117464341
4-amino-4-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)butanoic acid (PubChem CID 117464341) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 4-amino-4-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)butanoic acid.
| Compound Name | 4-amino-4-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117464341 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-amino-4-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)butanoic acid |
| SMILES | COc1c(C(N)CCC(=O)O)cc2c(c1Cl)OCO2 |
| InChI | InChI=1S/C12H14ClNO5/c1-17-11-6(7(14)2-3-9(15)16)4-8-12(10(11)13)19-5-18-8/h4,7H,2-3,5,14H2,1H3,(H,15,16) |
| InChIKey | GXIYVTZRVATUTL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |