C15H8F2O5 — CID 22079252
2-(6,7-difluoro-1,3-benzodioxole-5-carbonyl)benzoic acid (PubChem CID 22079252) has the molecular formula C15H8F2O5 and a molecular weight of 306.22 g/mol. Its IUPAC name is 2-(6,7-difluoro-1,3-benzodioxole-5-carbonyl)benzoic acid.
| Compound Name | 2-(6,7-difluoro-1,3-benzodioxole-5-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 22079252 |
| Molecular Formula | C15H8F2O5 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(6,7-difluoro-1,3-benzodioxole-5-carbonyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)c1cc2c(c(F)c1F)OCO2 |
| InChI | InChI=1S/C15H8F2O5/c16-11-9(5-10-14(12(11)17)22-6-21-10)13(18)7-3-1-2-4-8(7)15(19)20/h1-5H,6H2,(H,19,20) |
| InChIKey | ZFKDCDGOGNEELG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |