About benzene;1,3-benzodioxole
benzene;1,3-benzodioxole (PubChem CID 158998325) has the molecular formula C13H12O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is benzene;1,3-benzodioxole.
Molecular Properties
| Compound Name | benzene;1,3-benzodioxole |
| PubChem CID | 158998325 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | benzene;1,3-benzodioxole |
| SMILES | c1ccc2c(c1)OCO2.c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H6/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5-3-1/h1-4H,5H2;1-6H |
| InChIKey | JRAIFPOXHFYWLT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,3-benzodioxole?
The IUPAC name of benzene;1,3-benzodioxole (CID 158998325) is benzene;1,3-benzodioxole.
What is the SMILES notation for benzene;1,3-benzodioxole?
The canonical SMILES for benzene;1,3-benzodioxole is c1ccc2c(c1)OCO2.c1ccccc1.
What is the InChIKey of benzene;1,3-benzodioxole?
The InChIKey is JRAIFPOXHFYWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H6/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5-3-1/h1-4H,5H2;1-6H.
What are the key properties of benzene;1,3-benzodioxole?
benzene;1,3-benzodioxole has a molecular weight of 200.24 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,3-benzodioxole is sourced from PubChem (CID 158998325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).