C18H20N2O3 — CID 160531673
1,3-benzodioxole;1,3-dihydrobenzimidazol-2-one;ethene (PubChem CID 160531673) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1,3-benzodioxole;1,3-dihydrobenzimidazol-2-one;ethene.
| Compound Name | 1,3-benzodioxole;1,3-dihydrobenzimidazol-2-one;ethene |
|---|---|
| PubChem CID | 160531673 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1,3-benzodioxole;1,3-dihydrobenzimidazol-2-one;ethene |
| SMILES | C=C.C=C.O=c1[nH]c2ccccc2[nH]1.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6N2O.C7H6O2.2C2H4/c10-7-8-5-3-1-2-4-6(5)9-7;1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-4H,(H2,8,9,10);1-4H,5H2;2*1-2H2 |
| InChIKey | QVPXHHRDLPLTLP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|