C16H11NO3 — CID 10901503
2-(1,3-benzodioxol-5-yl)-1H-quinolin-4-one (PubChem CID 10901503) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1H-quinolin-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 10901503 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1H-quinolin-4-one |
| SMILES | O=c1cc(-c2ccc3c(c2)OCO3)[nH]c2ccccc12 |
| InChI | InChI=1S/C16H11NO3/c18-14-8-13(17-12-4-2-1-3-11(12)14)10-5-6-15-16(7-10)20-9-19-15/h1-8H,9H2,(H,17,18) |
| InChIKey | XZLHQSQFBBOXIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |