C22H23NO3 — CID 10450485
2-[6-(1,3-benzodioxol-5-yl)hexyl]-1H-quinolin-4-one (PubChem CID 10450485) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)hexyl]-1H-quinolin-4-one.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)hexyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 10450485 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)hexyl]-1H-quinolin-4-one |
| SMILES | O=c1cc(CCCCCCc2ccc3c(c2)OCO3)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23NO3/c24-20-14-17(23-19-10-6-5-9-18(19)20)8-4-2-1-3-7-16-11-12-21-22(13-16)26-15-25-21/h5-6,9-14H,1-4,7-8,15H2,(H,23,24) |
| InChIKey | CKZPIJIYEBHURL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|