C16H21NO — CID 172676764
2-heptyl-1H-quinolin-4-one (PubChem CID 172676764) has the molecular formula C16H21NO and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-heptyl-1H-quinolin-4-one.
| Compound Name | 2-heptyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 172676764 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-heptyl-1H-quinolin-4-one |
| SMILES | CCCCCCCc1cc(=O)[13c]2[13cH][13cH][13cH][13cH][13c]2[nH]1 |
| InChI | InChI=1S/C16H21NO/c1-2-3-4-5-6-9-13-12-16(18)14-10-7-8-11-15(14)17-13/h7-8,10-12H,2-6,9H2,1H3,(H,17,18)/i7+1,8+1,10+1,11+1,14+1,15+1 |
| InChIKey | UYRHHBXYXSYGHA-VUZSSQIGSA-N |
| XLogP | 4.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|