C15H12N2O3 — CID 57250326
3-(1,3-benzodioxol-5-ylmethyl)-1H-benzimidazol-2-one (PubChem CID 57250326) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1H-benzimidazol-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 57250326 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O3/c18-15-16-11-3-1-2-4-12(11)17(15)8-10-5-6-13-14(7-10)20-9-19-13/h1-7H,8-9H2,(H,16,18) |
| InChIKey | LDMIZBBEDRZRMB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |