About 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole
6-phenyl-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 4067102) has the molecular formula C15H11NO2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole.
Molecular Properties
| Compound Name | 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole |
| PubChem CID | 4067102 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | c1ccc(-c2cc3cc4c(cc3[nH]2)OCO4)cc1 |
| InChI | InChI=1S/C15H11NO2/c1-2-4-10(5-3-1)12-6-11-7-14-15(18-9-17-14)8-13(11)16-12/h1-8,16H,9H2 |
| InChIKey | OURPDRQDIRKULF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole?
The IUPAC name of 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole (CID 4067102) is 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole.
What is the SMILES notation for 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole?
The canonical SMILES for 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole is c1ccc(-c2cc3cc4c(cc3[nH]2)OCO4)cc1.
What is the InChIKey of 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole?
The InChIKey is OURPDRQDIRKULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c1-2-4-10(5-3-1)12-6-11-7-14-15(18-9-17-14)8-13(11)16-12/h1-8,16H,9H2.
What are the key properties of 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole?
6-phenyl-5H-[1,3]dioxolo[4,5-f]indole has a molecular weight of 237.26 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole is sourced from PubChem (CID 4067102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).