C15H11NO2 — CID 4067102
6-phenyl-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 4067102) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 4067102 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-phenyl-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | c1ccc(-c2cc3cc4c(cc3[nH]2)OCO4)cc1 |
| InChI | InChI=1S/C15H11NO2/c1-2-4-10(5-3-1)12-6-11-7-14-15(18-9-17-14)8-13(11)16-12/h1-8,16H,9H2 |
| InChIKey | OURPDRQDIRKULF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |