C12H9NO5 — CID 82048474
2-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)acetic acid (PubChem CID 82048474) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)acetic acid.
| Compound Name | 2-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)acetic acid |
|---|---|
| PubChem CID | 82048474 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)acetic acid |
| SMILES | O=C(O)Cc1cc2cc3c(cc2[nH]c1=O)OCO3 |
| InChI | InChI=1S/C12H9NO5/c14-11(15)3-7-1-6-2-9-10(18-5-17-9)4-8(6)13-12(7)16/h1-2,4H,3,5H2,(H,13,16)(H,14,15) |
| InChIKey | UWXWBYWRYNRDRA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |