C11H7NO4 — CID 3145231
6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde (PubChem CID 3145231) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde.
| Compound Name | 6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 3145231 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde |
| SMILES | O=Cc1cc2cc3c(cc2[nH]c1=O)OCO3 |
| InChI | InChI=1S/C11H7NO4/c13-4-7-1-6-2-9-10(16-5-15-9)3-8(6)12-11(7)14/h1-4H,5H2,(H,12,14) |
| InChIKey | JHECNOLILDQPIP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|