C17H12N4O4 — CID 135651698
N-[(E)-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 135651698) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is N-[(E)-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135651698 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[(E)-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1cc2cc3c(cc2[nH]c1=O)OCO3)c1ccncc1 |
| InChI | InChI=1S/C17H12N4O4/c22-16-12(8-19-21-17(23)10-1-3-18-4-2-10)5-11-6-14-15(25-9-24-14)7-13(11)20-16/h1-8H,9H2,(H,20,22)(H,21,23)/b19-8+ |
| InChIKey | KIKCFFKNSCDIKS-UFWORHAWSA-N |
| XLogP | 1.42 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|