C14H10N4O5 — CID 5333683
N-[(E)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 5333683) has the molecular formula C14H10N4O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is N-[(E)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 5333683 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-[(E)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1cc2c(c([N+](=O)[O-])c1)OCO2)c1ccncc1 |
| InChI | InChI=1S/C14H10N4O5/c19-14(10-1-3-15-4-2-10)17-16-7-9-5-11(18(20)21)13-12(6-9)22-8-23-13/h1-7H,8H2,(H,17,19)/b16-7+ |
| InChIKey | HTQOZSORPAAVIS-FRKPEAEDSA-N |
| XLogP | 1.48 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|