C15H9Cl3N2O3 — CID 1001986
3,4-dichloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]benzamide (PubChem CID 1001986) has the molecular formula C15H9Cl3N2O3 and a molecular weight of 371.61 g/mol. Its IUPAC name is 3,4-dichloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 1001986 |
| Molecular Formula | C15H9Cl3N2O3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 3,4-dichloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Cl)OCO2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl3N2O3/c16-10-2-1-8(3-12(10)18)15(21)20-19-6-9-4-13-14(5-11(9)17)23-7-22-13/h1-6H,7H2,(H,20,21) |
| InChIKey | HWCGAHXAKJGTLQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|