C13H10BrClN4O3 — CID 1028419
4-bromo-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1-methylpyrazole-3-carboxamide (PubChem CID 1028419) has the molecular formula C13H10BrClN4O3 and a molecular weight of 385.61 g/mol. Its IUPAC name is 4-bromo-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1028419 |
| Molecular Formula | C13H10BrClN4O3 |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 4-bromo-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(Br)c(C(=O)NN=Cc2cc3c(cc2Cl)OCO3)n1 |
| InChI | InChI=1S/C13H10BrClN4O3/c1-19-5-8(14)12(18-19)13(20)17-16-4-7-2-10-11(3-9(7)15)22-6-21-10/h2-5H,6H2,1H3,(H,17,20) |
| InChIKey | SRJVWXOICWFAMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|