C11H8BrN5O4 — CID 5497402
4-amino-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 5497402) has the molecular formula C11H8BrN5O4 and a molecular weight of 354.12 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 5497402 |
| Molecular Formula | C11H8BrN5O4 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 4-amino-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)N/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C11H8BrN5O4/c12-6-2-8-7(19-4-20-8)1-5(6)3-14-15-11(18)9-10(13)17-21-16-9/h1-3H,4H2,(H2,13,17)(H,15,18)/b14-3- |
| InChIKey | SIBIEMIPWWZVMB-BNNQUZSASA-N |
| XLogP | 0.91 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|