C11H9Br2N5O4 — CID 135606159
4-amino-N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 135606159) has the molecular formula C11H9Br2N5O4 and a molecular weight of 435.03 g/mol. Its IUPAC name is 4-amino-N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 135606159 |
| Molecular Formula | C11H9Br2N5O4 |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 432.90 |
| IUPAC Name | 4-amino-N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2nonc2N)c(Br)c(Br)c1O |
| InChI | InChI=1S/C11H9Br2N5O4/c1-21-5-2-4(6(12)7(13)9(5)19)3-15-16-11(20)8-10(14)18-22-17-8/h2-3,19H,1H3,(H2,14,18)(H,16,20)/b15-3+ |
| InChIKey | SKANBGVFMOQGTM-CRKCGEKBSA-N |
| XLogP | 1.65 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|