C11H10N6O6 — CID 135909224
4-amino-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 135909224) has the molecular formula C11H10N6O6 and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 135909224 |
| Molecular Formula | C11H10N6O6 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-amino-N-[(Z)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1c(O)ccc(/C=N\NC(=O)c2nonc2N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N6O6/c1-22-9-6(18)3-2-5(8(9)17(20)21)4-13-14-11(19)7-10(12)16-23-15-7/h2-4,18H,1H3,(H2,12,16)(H,14,19)/b13-4- |
| InChIKey | MSQZHVDSUYFTOF-PQMHYQBVSA-N |
| XLogP | 0.04 |
| TPSA | 179.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|