C13H13N5O5 — CID 135644192
N-[(E)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 135644192) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135644192 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxy-2-nitrophenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | COc1c(O)ccc(/C=N/NC(=O)c2cc(C)[nH]n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N5O5/c1-7-5-9(16-15-7)13(20)17-14-6-8-3-4-10(19)12(23-2)11(8)18(21)22/h3-6,19H,1-2H3,(H,15,16)(H,17,20)/b14-6+ |
| InChIKey | GZSKOLYLDPKRGS-MKMNVTDBSA-N |
| XLogP | 1.10 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|