C13H13Br2ClN4O3 — CID 163326149
N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 163326149) has the molecular formula C13H13Br2ClN4O3 and a molecular weight of 468.53 g/mol. Its IUPAC name is N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163326149 |
| Molecular Formula | C13H13Br2ClN4O3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 465.90 |
| IUPAC Name | N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(C)[nH]n2)c(Br)c(Br)c1O.Cl |
| InChI | InChI=1S/C13H12Br2N4O3.ClH/c1-6-3-8(18-17-6)13(21)19-16-5-7-4-9(22-2)12(20)11(15)10(7)14;/h3-5,20H,1-2H3,(H,17,18)(H,19,21);1H/b16-5+; |
| InChIKey | QRPDPZKOMOLSNR-SYRJXDITSA-N |
| XLogP | 3.14 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|