C16H13Br2IN2O4 — CID 3295001
N-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-iodo-3-methoxybenzamide (PubChem CID 3295001) has the molecular formula C16H13Br2IN2O4 and a molecular weight of 584.00 g/mol. Its IUPAC name is N-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-iodo-3-methoxybenzamide.
| Compound Name | N-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-iodo-3-methoxybenzamide |
|---|---|
| PubChem CID | 3295001 |
| Molecular Formula | C16H13Br2IN2O4 |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 581.83 |
| IUPAC Name | N-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-iodo-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NN=Cc2cc(OC)c(O)c(Br)c2Br)ccc1I |
| InChI | InChI=1S/C16H13Br2IN2O4/c1-24-11-5-8(3-4-10(11)19)16(23)21-20-7-9-6-12(25-2)15(22)14(18)13(9)17/h3-7,22H,1-2H3,(H,21,23) |
| InChIKey | VYNIOIKPPUPYTK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|