C12H12BrN5O4 — CID 1004986
4-amino-N-[(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 1004986) has the molecular formula C12H12BrN5O4 and a molecular weight of 370.16 g/mol. Its IUPAC name is 4-amino-N-[(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 1004986 |
| Molecular Formula | C12H12BrN5O4 |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-amino-N-[(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2nonc2N)c(OC)cc1Br |
| InChI | InChI=1S/C12H12BrN5O4/c1-20-8-4-7(13)9(21-2)3-6(8)5-15-16-12(19)10-11(14)18-22-17-10/h3-5H,1-2H3,(H2,14,18)(H,16,19) |
| InChIKey | QHTKXMUBFRJAOZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|