C12H13BrN6O3 — CID 40542746
4-amino-N'-[(Z)-(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 40542746) has the molecular formula C12H13BrN6O3 and a molecular weight of 369.18 g/mol. Its IUPAC name is 4-amino-N'-[(Z)-(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(Z)-(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 40542746 |
| Molecular Formula | C12H13BrN6O3 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 4-amino-N'-[(Z)-(4-bromo-2,5-dimethoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COc1cc(/C=N\N=C(/N)c2nonc2N)c(OC)cc1Br |
| InChI | InChI=1S/C12H13BrN6O3/c1-20-8-4-7(13)9(21-2)3-6(8)5-16-17-11(14)10-12(15)19-22-18-10/h3-5H,1-2H3,(H2,14,17)(H2,15,19)/b16-5- |
| InChIKey | ZDTZUNONECLLCD-BNCCVWRVSA-N |
| XLogP | 1.17 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|