C10H13BrN4O3 — CID 139982922
2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 139982922) has the molecular formula C10H13BrN4O3 and a molecular weight of 317.14 g/mol. Its IUPAC name is 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 139982922 |
| Molecular Formula | C10H13BrN4O3 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | COc1cc(OC)c(C=N/N=C(/N)NO)cc1Br |
| InChI | InChI=1S/C10H13BrN4O3/c1-17-8-4-9(18-2)7(11)3-6(8)5-13-14-10(12)15-16/h3-5,16H,1-2H3,(H3,12,14,15) |
| InChIKey | WHYZEUUSKWLZRC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|