C9H11BrN4O2 — CID 168590552
2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]guanidine (PubChem CID 168590552) has the molecular formula C9H11BrN4O2 and a molecular weight of 287.12 g/mol. Its IUPAC name is 2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590552 |
| Molecular Formula | C9H11BrN4O2 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(Br)c(C=NN=C(N)N)cc1O |
| InChI | InChI=1S/C9H11BrN4O2/c1-16-8-3-6(10)5(2-7(8)15)4-13-14-9(11)12/h2-4,15H,1H3,(H4,11,12,14) |
| InChIKey | SJDXNKHBQTZQCR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|