C8H9BrN2O2S — CID 164566061
4-bromo-2-methoxy-5-[(E)-(sulfanylhydrazinylidene)methyl]phenol (PubChem CID 164566061) has the molecular formula C8H9BrN2O2S and a molecular weight of 277.14 g/mol. Its IUPAC name is 4-bromo-2-methoxy-5-[(E)-(sulfanylhydrazinylidene)methyl]phenol.
| Compound Name | 4-bromo-2-methoxy-5-[(E)-(sulfanylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 164566061 |
| Molecular Formula | C8H9BrN2O2S |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 4-bromo-2-methoxy-5-[(E)-(sulfanylhydrazinylidene)methyl]phenol |
| SMILES | COc1cc(Br)c(/C=N/NS)cc1O |
| InChI | InChI=1S/C8H9BrN2O2S/c1-13-8-3-6(9)5(2-7(8)12)4-10-11-14/h2-4,11-12,14H,1H3/b10-4+ |
| InChIKey | MLKKYRNXPQFCPT-ONNFQVAWSA-N |
| XLogP | 1.93 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|