C13H17BrN2O4 — CID 135647526
tert-butyl N-[(E)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]carbamate (PubChem CID 135647526) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is tert-butyl N-[(E)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135647526 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | tert-butyl N-[(E)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
| SMILES | COc1cc(/C=N/NC(=O)OC(C)(C)C)c(Br)cc1O |
| InChI | InChI=1S/C13H17BrN2O4/c1-13(2,3)20-12(18)16-15-7-8-5-11(19-4)10(17)6-9(8)14/h5-7,17H,1-4H3,(H,16,18)/b15-7+ |
| InChIKey | CMAWCXVSRGONIX-VIZOYTHASA-N |
| XLogP | 3.02 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|