C19H28N4O6 — CID 4557367
tert-butyl N-[[2-hydroxy-3-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl]methylideneamino]carbamate (PubChem CID 4557367) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is tert-butyl N-[[2-hydroxy-3-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[[2-hydroxy-3-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 4557367 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl N-[[2-hydroxy-3-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl]methylideneamino]carbamate |
| SMILES | COc1cc(C=NNC(=O)OC(C)(C)C)cc(C=NNC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C19H28N4O6/c1-18(2,3)28-16(25)22-20-10-12-8-13(15(24)14(9-12)27-7)11-21-23-17(26)29-19(4,5)6/h8-11,24H,1-7H3,(H,22,25)(H,23,26) |
| InChIKey | UTXBROJQJIPSGL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|