C13H17BrN2O3 — CID 9074914
tert-butyl N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]carbamate (PubChem CID 9074914) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 9074914 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | tert-butyl N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]carbamate |
| SMILES | COc1ccc(/C=N\NC(=O)OC(C)(C)C)cc1Br |
| InChI | InChI=1S/C13H17BrN2O3/c1-13(2,3)19-12(17)16-15-8-9-5-6-11(18-4)10(14)7-9/h5-8H,1-4H3,(H,16,17)/b15-8- |
| InChIKey | KREMOUBBNHBYRC-NVNXTCNLSA-N |
| XLogP | 3.32 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|