C15H18BrNO5 — CID 122484131
(Z)-3-(3-bromo-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid (PubChem CID 122484131) has the molecular formula C15H18BrNO5 and a molecular weight of 372.22 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid.
| Compound Name | (Z)-3-(3-bromo-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 122484131 |
| Molecular Formula | C15H18BrNO5 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (Z)-3-(3-bromo-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\NC(=O)OC(C)(C)C)C(=O)O)cc1Br |
| InChI | InChI=1S/C15H18BrNO5/c1-15(2,3)22-14(20)17-11(13(18)19)8-9-5-6-12(21-4)10(16)7-9/h5-8H,1-4H3,(H,17,20)(H,18,19)/b11-8- |
| InChIKey | PODWAHWVRFRXPI-FLIBITNWSA-N |
| XLogP | 3.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|